C22H32FN3O — CID 165418030
(5-fluoro-2-pyridinyl)-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone (PubChem CID 165418030) has the molecular formula C22H32FN3O and a molecular weight of 373.52 g/mol. Its IUPAC name is (5-fluoro-2-pyridinyl)-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone.
| Compound Name | (5-fluoro-2-pyridinyl)-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
|---|---|
| PubChem CID | 165418030 |
| Molecular Formula | C22H32FN3O |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | (5-fluoro-2-pyridinyl)-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccc(F)cn3)C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C22H32FN3O/c1-15(2)6-9-21-17-11-16(20-5-3-4-10-26(20)21)13-25(14-17)22(27)19-8-7-18(23)12-24-19/h7-8,12,15-17,20-21H,3-6,9-11,13-14H2,1-2H3/t16-,17+,20+,21+/m1/s1 |
| InChIKey | SXSUFWKRCVICNA-SEONNTABSA-N |
| XLogP | 3.97 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |