C25H35N5O — CID 163312935
[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 163312935) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is [(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | [(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 163312935 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | [(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(C(=O)c3cccc(-n4cnnc4)c3)C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C25H35N5O/c1-18(2)9-10-24-21-12-20(23-8-3-4-11-30(23)24)14-28(15-21)25(31)19-6-5-7-22(13-19)29-16-26-27-17-29/h5-7,13,16-18,20-21,23-24H,3-4,8-12,14-15H2,1-2H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | DCFWAHWHJAPAHU-KJBBBAAKSA-N |
| XLogP | 4.02 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |