C23H37N3O4S — CID 171316614
formic acid;(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(5-methylsulfonyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 171316614) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is formic acid;(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(5-methylsulfonyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | formic acid;(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(5-methylsulfonyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 171316614 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | formic acid;(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(5-methylsulfonyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(c3ccc(S(C)(=O)=O)cn3)C2)[C@@H]2CCCCN21.O=CO |
| InChI | InChI=1S/C22H35N3O2S.CH2O2/c1-16(2)7-9-21-18-12-17(20-6-4-5-11-25(20)21)14-24(15-18)22-10-8-19(13-23-22)28(3,26)27;2-1-3/h8,10,13,16-18,20-21H,4-7,9,11-12,14-15H2,1-3H3;1H,(H,2,3)/t17-,18+,20+,21+;/m1./s1 |
| InChIKey | IZULHXGRPFDJGO-LIJKWCKLSA-N |
| XLogP | 3.30 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|