C20H29N3O6S — CID 172896933
formic acid;8-(5-methylsulfonyl-2-pyridinyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 172896933) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is formic acid;8-(5-methylsulfonyl-2-pyridinyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | formic acid;8-(5-methylsulfonyl-2-pyridinyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 172896933 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | formic acid;8-(5-methylsulfonyl-2-pyridinyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | CS(=O)(=O)c1ccc(N2CCC3(CC2)CC(CN2CCCC2)OC3=O)nc1.O=CO |
| InChI | InChI=1S/C19H27N3O4S.CH2O2/c1-27(24,25)16-4-5-17(20-13-16)22-10-6-19(7-11-22)12-15(26-18(19)23)14-21-8-2-3-9-21;2-1-3/h4-5,13,15H,2-3,6-12,14H2,1H3;1H,(H,2,3) |
| InChIKey | FFGDTEWTNAKPIU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|