C24H37N3O4 — CID 166598134
[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid (PubChem CID 166598134) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is [(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid.
| Compound Name | [(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid |
|---|---|
| PubChem CID | 166598134 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | [(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid |
| SMILES | Cc1cc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2CCCC[C@@H]32)no1.O=CO |
| InChI | InChI=1S/C23H35N3O2.CH2O2/c1-16-11-20(24-28-16)23(27)25-14-18-13-19(15-25)22(12-17-7-3-2-4-8-17)26-10-6-5-9-21(18)26;2-1-3/h11,17-19,21-22H,2-10,12-15H2,1H3;1H,(H,2,3)/t18-,19+,21+,22+;/m1./s1 |
| InChIKey | HQSPWDZEYUNQJB-HBSYUVOWSA-N |
| XLogP | 3.97 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|