C23H29N3O3 — CID 163313560
[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1,2-oxazol-3-yl)methanone (PubChem CID 163313560) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1,2-oxazol-3-yl)methanone.
| Compound Name | [(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 163313560 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1,2-oxazol-3-yl)methanone |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)c4ccon4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C23H29N3O3/c1-28-19-6-4-5-16(11-19)12-22-18-13-17(21-7-2-3-9-26(21)22)14-25(15-18)23(27)20-8-10-29-24-20/h4-6,8,10-11,17-18,21-22H,2-3,7,9,12-15H2,1H3/t17-,18+,21+,22+/m1/s1 |
| InChIKey | KQODOHJKSBYKSW-KSCDAYEDSA-N |
| XLogP | 3.24 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |