C23H31N5O — CID 163306963
4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-2-amine (PubChem CID 163306963) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-2-amine.
| Compound Name | 4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163306963 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4ccnc(N)n4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C23H31N5O/c1-29-19-6-4-5-16(11-19)12-21-18-13-17(20-7-2-3-10-28(20)21)14-27(15-18)22-8-9-25-23(24)26-22/h4-6,8-9,11,17-18,20-21H,2-3,7,10,12-15H2,1H3,(H2,24,25,26)/t17-,18+,20+,21+/m1/s1 |
| InChIKey | OXRMVCDELXIDGV-ZFMNYDKASA-N |
| XLogP | 2.99 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |