C25H30N4O — CID 164690924
2-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-4-carbonitrile (PubChem CID 164690924) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 164690924 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-4-carbonitrile |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4cc(C#N)ccn4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C25H30N4O/c1-30-22-6-4-5-18(11-22)12-24-21-14-20(23-7-2-3-10-29(23)24)16-28(17-21)25-13-19(15-26)8-9-27-25/h4-6,8-9,11,13,20-21,23-24H,2-3,7,10,12,14,16-17H2,1H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | POEFBBZRSVKQHE-KJBBBAAKSA-N |
| XLogP | 3.88 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |