C25H35N3O2 — CID 163310498
[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone (PubChem CID 163310498) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone.
| Compound Name | [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
|---|---|
| PubChem CID | 163310498 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)C4[C@H]5CNC[C@@H]45)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C25H35N3O2/c1-30-19-6-4-5-16(9-19)10-23-18-11-17(22-7-2-3-8-28(22)23)14-27(15-18)25(29)24-20-12-26-13-21(20)24/h4-6,9,17-18,20-24,26H,2-3,7-8,10-15H2,1H3/t17-,18+,20-,21+,22+,23+,24?/m1/s1 |
| InChIKey | XDCZLDMHPMOCDN-QDBCFJSESA-N |
| XLogP | 2.40 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |