C22H29FN6 — CID 164699904
6-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-2,4-diamine (PubChem CID 164699904) has the molecular formula C22H29FN6 and a molecular weight of 396.51 g/mol. Its IUPAC name is 6-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-2,4-diamine.
| Compound Name | 6-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164699904 |
| Molecular Formula | C22H29FN6 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 6-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1cc(N2C[C@H]3C[C@@H](C2)[C@H](Cc2cccc(F)c2)N2CCCC[C@@H]32)nc(N)n1 |
| InChI | InChI=1S/C22H29FN6/c23-17-5-3-4-14(8-17)9-19-16-10-15(18-6-1-2-7-29(18)19)12-28(13-16)21-11-20(24)26-22(25)27-21/h3-5,8,11,15-16,18-19H,1-2,6-7,9-10,12-13H2,(H4,24,25,26,27)/t15-,16+,18+,19+/m1/s1 |
| InChIKey | YVPOHLOLSQYKJJ-NEPXVJNWSA-N |
| XLogP | 2.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |