C22H26ClFN4O — CID 163304972
(4-chloro-1H-pyrazol-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone (PubChem CID 163304972) has the molecular formula C22H26ClFN4O and a molecular weight of 416.93 g/mol. Its IUPAC name is (4-chloro-1H-pyrazol-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone.
| Compound Name | (4-chloro-1H-pyrazol-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
|---|---|
| PubChem CID | 163304972 |
| Molecular Formula | C22H26ClFN4O |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (4-chloro-1H-pyrazol-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
| SMILES | O=C(c1[nH]ncc1Cl)N1C[C@H]2C[C@@H](C1)[C@H](Cc1cccc(F)c1)N1CCCC[C@@H]21 |
| InChI | InChI=1S/C22H26ClFN4O/c23-18-11-25-26-21(18)22(29)27-12-15-10-16(13-27)20(28-7-2-1-6-19(15)28)9-14-4-3-5-17(24)8-14/h3-5,8,11,15-16,19-20H,1-2,6-7,9-10,12-13H2,(H,25,26)/t15-,16+,19+,20+/m1/s1 |
| InChIKey | BCXKQKSNNSFUAW-LPWQTFTOSA-N |
| XLogP | 3.76 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |