C26H28FN3O — CID 163313856
3-[(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-5-fluorobenzonitrile (PubChem CID 163313856) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-[(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-5-fluorobenzonitrile.
| Compound Name | 3-[(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 163313856 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-[(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](Cc2ccccc2)N2CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C26H28FN3O/c27-23-11-19(15-28)10-20(14-23)26(31)29-16-21-13-22(17-29)25(12-18-6-2-1-3-7-18)30-9-5-4-8-24(21)30/h1-3,6-7,10-11,14,21-22,24-25H,4-5,8-9,12-13,16-17H2/t21-,22+,24+,25+/m1/s1 |
| InChIKey | DNUUGGDWXDVYSC-NJRQHTIISA-N |
| XLogP | 4.26 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |