C23H29FN4O — CID 165418010
1-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyrazol-1-ylethanone (PubChem CID 165418010) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyrazol-1-ylethanone.
| Compound Name | 1-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 165418010 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyrazol-1-ylethanone |
| SMILES | O=C(Cn1cccn1)N1C[C@H]2C[C@@H](C1)[C@H](Cc1cccc(F)c1)N1CCCC[C@@H]21 |
| InChI | InChI=1S/C23H29FN4O/c24-20-6-3-5-17(11-20)12-22-19-13-18(21-7-1-2-10-28(21)22)14-26(15-19)23(29)16-27-9-4-8-25-27/h3-6,8-9,11,18-19,21-22H,1-2,7,10,12-16H2/t18-,19+,21+,22+/m1/s1 |
| InChIKey | YORRRZPQSZGVKE-WAGURGNTSA-N |
| XLogP | 2.97 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |