C23H28N4O3 — CID 163316686
(1R,2S,8S,9S)-11-(1H-imidazole-5-carbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 163316686) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(1H-imidazole-5-carbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(1H-imidazole-5-carbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 163316686 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (1R,2S,8S,9S)-11-(1H-imidazole-5-carbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)c4cnc[nH]4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-30-18-5-2-4-15(8-18)9-21-17-10-16(20-6-3-7-22(28)27(20)21)12-26(13-17)23(29)19-11-24-14-25-19/h2,4-5,8,11,14,16-17,20-21H,3,6-7,9-10,12-13H2,1H3,(H,24,25)/t16-,17+,20+,21+/m1/s1 |
| InChIKey | DAUHXYODZNGUNK-SEONNTABSA-N |
| XLogP | 2.50 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |