C24H31N5O2 — CID 164687944
(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[3-(methylamino)pyrazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164687944) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[3-(methylamino)pyrazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[3-(methylamino)pyrazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164687944 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[3-(methylamino)pyrazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CNc1nccnc1N1C[C@H]2C[C@@H](C1)[C@H](Cc1cccc(OC)c1)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C24H31N5O2/c1-25-23-24(27-10-9-26-23)28-14-17-13-18(15-28)21(29-20(17)7-4-8-22(29)30)12-16-5-3-6-19(11-16)31-2/h3,5-6,9-11,17-18,20-21H,4,7-8,12-15H2,1-2H3,(H,25,26)/t17-,18+,20+,21+/m1/s1 |
| InChIKey | VWBHMZSIUUFAKC-ZFMNYDKASA-N |
| XLogP | 2.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |