C24H33N3O3 — CID 165417524
(1R,2S,8S,9S)-11-(1-aminocyclobutanecarbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 165417524) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(1-aminocyclobutanecarbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(1-aminocyclobutanecarbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 165417524 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (1R,2S,8S,9S)-11-(1-aminocyclobutanecarbonyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)C4(N)CCC4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C24H33N3O3/c1-30-19-6-2-5-16(11-19)12-21-18-13-17(20-7-3-8-22(28)27(20)21)14-26(15-18)23(29)24(25)9-4-10-24/h2,5-6,11,17-18,20-21H,3-4,7-10,12-15,25H2,1H3/t17-,18+,20+,21+/m1/s1 |
| InChIKey | SUNFSVNGZTUQKX-ZFMNYDKASA-N |
| XLogP | 2.35 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |