C23H29N3O2S — CID 164688316
(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164688316) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164688316 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(Cc4nccs4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-28-19-5-2-4-16(10-19)11-21-18-12-17(20-6-3-7-23(27)26(20)21)13-25(14-18)15-22-24-8-9-29-22/h2,4-5,8-10,17-18,20-21H,3,6-7,11-15H2,1H3/t17-,18+,20+,21+/m1/s1 |
| InChIKey | JTHDQUQPCSZXEV-ZFMNYDKASA-N |
| XLogP | 3.60 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |