C23H32N4O2S — CID 171992004
(1S,2S,8R,9R)-N-(cyclohexen-1-ylmethyl)-6-oxo-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171992004) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is (1S,2S,8R,9R)-N-(cyclohexen-1-ylmethyl)-6-oxo-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1S,2S,8R,9R)-N-(cyclohexen-1-ylmethyl)-6-oxo-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171992004 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (1S,2S,8R,9R)-N-(cyclohexen-1-ylmethyl)-6-oxo-11-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | O=C(NCC1=CCCCC1)[C@H]1[C@@H]2C[C@@H](CN(Cc3nccs3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C23H32N4O2S/c28-21-8-4-7-19-17-11-18(14-26(13-17)15-20-24-9-10-30-20)22(27(19)21)23(29)25-12-16-5-2-1-3-6-16/h5,9-10,17-19,22H,1-4,6-8,11-15H2,(H,25,29)/t17-,18+,19-,22+/m0/s1 |
| InChIKey | ROFLTFUJNUIUOS-LMVRJCEZSA-N |
| XLogP | 2.96 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|