C17H24FN3OS — CID 128970728
2-(cyclohexen-1-yl)-N-[[(2S,4S)-4-fluoro-1-(1,3-thiazol-2-ylmethyl)pyrrolidin-2-yl]methyl]acetamide (PubChem CID 128970728) has the molecular formula C17H24FN3OS and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[(2S,4S)-4-fluoro-1-(1,3-thiazol-2-ylmethyl)pyrrolidin-2-yl]methyl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[(2S,4S)-4-fluoro-1-(1,3-thiazol-2-ylmethyl)pyrrolidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 128970728 |
| Molecular Formula | C17H24FN3OS |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[(2S,4S)-4-fluoro-1-(1,3-thiazol-2-ylmethyl)pyrrolidin-2-yl]methyl]acetamide |
| SMILES | O=C(CC1=CCCCC1)NC[C@@H]1C[C@H](F)CN1Cc1nccs1 |
| InChI | InChI=1S/C17H24FN3OS/c18-14-9-15(21(11-14)12-17-19-6-7-23-17)10-20-16(22)8-13-4-2-1-3-5-13/h4,6-7,14-15H,1-3,5,8-12H2,(H,20,22)/t14-,15-/m0/s1 |
| InChIKey | GYOIRHRYCYMQRW-GJZGRUSLSA-N |
| XLogP | 3.06 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|