C25H27N5O2 — CID 171992027
(1S,2S,8R,9R)-N-benzyl-11-(5-cyano-2-pyridinyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171992027) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (1S,2S,8R,9R)-N-benzyl-11-(5-cyano-2-pyridinyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1S,2S,8R,9R)-N-benzyl-11-(5-cyano-2-pyridinyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171992027 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (1S,2S,8R,9R)-N-benzyl-11-(5-cyano-2-pyridinyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | N#Cc1ccc(N2C[C@@H]3C[C@H](C2)[C@H](C(=O)NCc2ccccc2)N2C(=O)CCC[C@@H]32)nc1 |
| InChI | InChI=1S/C25H27N5O2/c26-12-18-9-10-22(27-14-18)29-15-19-11-20(16-29)24(30-21(19)7-4-8-23(30)31)25(32)28-13-17-5-2-1-3-6-17/h1-3,5-6,9-10,14,19-21,24H,4,7-8,11,13,15-16H2,(H,28,32)/t19-,20+,21-,24+/m0/s1 |
| InChIKey | YGCQTIUKJBYTBA-SEDAZVQISA-N |
| XLogP | 2.48 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |