C22H27N5O2S — CID 171992305
(1S,2S,8R,9R)-6-oxo-11-(pyridin-4-ylmethyl)-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171992305) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is (1S,2S,8R,9R)-6-oxo-11-(pyridin-4-ylmethyl)-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1S,2S,8R,9R)-6-oxo-11-(pyridin-4-ylmethyl)-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171992305 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (1S,2S,8R,9R)-6-oxo-11-(pyridin-4-ylmethyl)-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | O=C(NCc1nccs1)[C@H]1[C@@H]2C[C@@H](CN(Cc3ccncc3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H27N5O2S/c28-20-3-1-2-18-16-10-17(14-26(13-16)12-15-4-6-23-7-5-15)21(27(18)20)22(29)25-11-19-24-8-9-30-19/h4-9,16-18,21H,1-3,10-14H2,(H,25,29)/t16-,17+,18-,21+/m0/s1 |
| InChIKey | FRUVINMQALLIRG-TWFHAPMSSA-N |
| XLogP | 2.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |