C21H29N7O2S — CID 171911656
(1R,2S,8R,9S)-6-oxo-11-(1,2-thiazol-4-ylmethyl)-N-[3-(triazol-1-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171911656) has the molecular formula C21H29N7O2S and a molecular weight of 443.58 g/mol. Its IUPAC name is (1R,2S,8R,9S)-6-oxo-11-(1,2-thiazol-4-ylmethyl)-N-[3-(triazol-1-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1R,2S,8R,9S)-6-oxo-11-(1,2-thiazol-4-ylmethyl)-N-[3-(triazol-1-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171911656 |
| Molecular Formula | C21H29N7O2S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (1R,2S,8R,9S)-6-oxo-11-(1,2-thiazol-4-ylmethyl)-N-[3-(triazol-1-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | O=C(NCCCn1ccnn1)[C@H]1[C@H]2C[C@H](CN(Cc3cnsc3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C21H29N7O2S/c29-19-4-1-3-18-16-9-17(13-26(12-16)11-15-10-24-31-14-15)20(28(18)19)21(30)22-5-2-7-27-8-6-23-25-27/h6,8,10,14,16-18,20H,1-5,7,9,11-13H2,(H,22,30)/t16-,17+,18+,20-/m1/s1 |
| InChIKey | CXNHQIFGUHBINY-DOADOZAASA-N |
| XLogP | 1.14 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|