C13H19N5O2 — CID 97126904
(3S)-1-cyclopropyl-5-oxo-N-[3-(triazol-1-yl)propyl]pyrrolidine-3-carboxamide (PubChem CID 97126904) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is (3S)-1-cyclopropyl-5-oxo-N-[3-(triazol-1-yl)propyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyclopropyl-5-oxo-N-[3-(triazol-1-yl)propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97126904 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3S)-1-cyclopropyl-5-oxo-N-[3-(triazol-1-yl)propyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCn1ccnn1)[C@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C13H19N5O2/c19-12-8-10(9-18(12)11-2-3-11)13(20)14-4-1-6-17-7-5-15-16-17/h5,7,10-11H,1-4,6,8-9H2,(H,14,20)/t10-/m0/s1 |
| InChIKey | RXLCATILHSNTDQ-JTQLQIEISA-N |
| XLogP | -0.20 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|