C17H28N6O2 — CID 126429358
1-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-[3-(triazol-1-yl)propyl]urea (PubChem CID 126429358) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-[3-(triazol-1-yl)propyl]urea.
| Compound Name | 1-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-[3-(triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 126429358 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-1-methyl-3-[3-(triazol-1-yl)propyl]urea |
| SMILES | CN(C[C@@H]1CC(=O)N(C2CCCC2)C1)C(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C17H28N6O2/c1-21(17(25)18-7-4-9-22-10-8-19-20-22)12-14-11-16(24)23(13-14)15-5-2-3-6-15/h8,10,14-15H,2-7,9,11-13H2,1H3,(H,18,25)/t14-/m0/s1 |
| InChIKey | JINJTPCVPTYECJ-AWEZNQCLSA-N |
| XLogP | 1.10 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|