C18H22F3N3O2 — CID 72925137
1-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-1-methyl-3-(3,4,5-trifluorophenyl)urea (PubChem CID 72925137) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-1-methyl-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-1-methyl-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 72925137 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-1-methyl-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CN(CC1CC(=O)N(C2CCCC2)C1)C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-23(18(26)22-12-7-14(19)17(21)15(20)8-12)9-11-6-16(25)24(10-11)13-4-2-3-5-13/h7-8,11,13H,2-6,9-10H2,1H3,(H,22,26) |
| InChIKey | IOQBKXOTKGRDPN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|