C23H29N5O2S — CID 171389190
(1R,2S,8R,9S)-6-oxo-N-(2-pyridin-3-ylethyl)-11-(1,3-thiazol-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171389190) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is (1R,2S,8R,9S)-6-oxo-N-(2-pyridin-3-ylethyl)-11-(1,3-thiazol-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1R,2S,8R,9S)-6-oxo-N-(2-pyridin-3-ylethyl)-11-(1,3-thiazol-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171389190 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (1R,2S,8R,9S)-6-oxo-N-(2-pyridin-3-ylethyl)-11-(1,3-thiazol-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | O=C(NCCc1cccnc1)[C@H]1[C@H]2C[C@H](CN(Cc3cncs3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C23H29N5O2S/c29-21-5-1-4-20-17-9-18(13-27(12-17)14-19-11-25-15-31-19)22(28(20)21)23(30)26-8-6-16-3-2-7-24-10-16/h2-3,7,10-11,15,17-18,20,22H,1,4-6,8-9,12-14H2,(H,26,30)/t17-,18+,20+,22-/m1/s1 |
| InChIKey | ZOKCUKJXRIRSOP-YSNWRPKNSA-N |
| XLogP | 2.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |