C24H31N5O2 — CID 171908673
(1R,2S,8R,9S)-11-benzyl-N-[2-(1H-imidazol-2-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171908673) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (1R,2S,8R,9S)-11-benzyl-N-[2-(1H-imidazol-2-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1R,2S,8R,9S)-11-benzyl-N-[2-(1H-imidazol-2-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171908673 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (1R,2S,8R,9S)-11-benzyl-N-[2-(1H-imidazol-2-yl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | O=C(NCCc1ncc[nH]1)[C@H]1[C@H]2C[C@H](CN(Cc3ccccc3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C24H31N5O2/c30-22-8-4-7-20-18-13-19(16-28(15-18)14-17-5-2-1-3-6-17)23(29(20)22)24(31)27-10-9-21-25-11-12-26-21/h1-3,5-6,11-12,18-20,23H,4,7-10,13-16H2,(H,25,26)(H,27,31)/t18-,19+,20+,23-/m1/s1 |
| InChIKey | UFUFZQWQCNCLAS-QTDGGUCWSA-N |
| XLogP | 1.97 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |