C26H28N4O — CID 164693519
(1R,2S,8S,9S)-8-benzyl-11-quinoxalin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164693519) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-benzyl-11-quinoxalin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-benzyl-11-quinoxalin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164693519 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (1R,2S,8S,9S)-8-benzyl-11-quinoxalin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C1CCC[C@H]2[C@@H]3C[C@@H](CN(c4cnc5ccccc5n4)C3)[C@H](Cc3ccccc3)N12 |
| InChI | InChI=1S/C26H28N4O/c31-26-12-6-11-23-19-14-20(24(30(23)26)13-18-7-2-1-3-8-18)17-29(16-19)25-15-27-21-9-4-5-10-22(21)28-25/h1-5,7-10,15,19-20,23-24H,6,11-14,16-17H2/t19-,20+,23+,24+/m1/s1 |
| InChIKey | QKEMJZWOQVILQZ-SHBJFUFKSA-N |
| XLogP | 4.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |