C23H32N2O3S — CID 164689883
(1R,2S,8S,9S)-8-benzyl-11-(1,1-dioxothian-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164689883) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-benzyl-11-(1,1-dioxothian-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-benzyl-11-(1,1-dioxothian-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164689883 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (1R,2S,8S,9S)-8-benzyl-11-(1,1-dioxothian-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C1CCC[C@H]2[C@@H]3C[C@@H](CN(C4CCS(=O)(=O)CC4)C3)[C@H](Cc3ccccc3)N12 |
| InChI | InChI=1S/C23H32N2O3S/c26-23-8-4-7-21-18-14-19(22(25(21)23)13-17-5-2-1-3-6-17)16-24(15-18)20-9-11-29(27,28)12-10-20/h1-3,5-6,18-22H,4,7-16H2/t18-,19+,21+,22+/m1/s1 |
| InChIKey | KAZAKXINYZFLRG-WAGURGNTSA-N |
| XLogP | 2.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |