C25H29N5O — CID 164693308
(1R,2S,8S,9S)-8-benzyl-11-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164693308) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-benzyl-11-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-benzyl-11-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164693308 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (1R,2S,8S,9S)-8-benzyl-11-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C1CCC[C@H]2[C@@H]3C[C@@H](CN(Cc4cccc5ncnn45)C3)[C@H](Cc3ccccc3)N12 |
| InChI | InChI=1S/C25H29N5O/c31-25-11-5-9-22-19-13-20(23(29(22)25)12-18-6-2-1-3-7-18)15-28(14-19)16-21-8-4-10-24-26-17-27-30(21)24/h1-4,6-8,10,17,19-20,22-23H,5,9,11-16H2/t19-,20+,22+,23+/m1/s1 |
| InChIKey | DWSYOBINSDOVRP-VAPSRWTKSA-N |
| XLogP | 3.17 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |