C21H27N5O2S — CID 164694001
(1R,2S,8S,9S)-11-(5-amino-1,3,4-thiadiazol-2-yl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164694001) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(5-amino-1,3,4-thiadiazol-2-yl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(5-amino-1,3,4-thiadiazol-2-yl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164694001 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (1R,2S,8S,9S)-11-(5-amino-1,3,4-thiadiazol-2-yl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4nnc(N)s4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C21H27N5O2S/c1-28-16-5-2-4-13(8-16)9-18-15-10-14(17-6-3-7-19(27)26(17)18)11-25(12-15)21-24-23-20(22)29-21/h2,4-5,8,14-15,17-18H,3,6-7,9-12H2,1H3,(H2,22,23)/t14-,15+,17+,18+/m1/s1 |
| InChIKey | ZEDPRQWUYKCXOW-FZCLSBEQSA-N |
| XLogP | 2.58 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |