C18H27NO — CID 10849883
2-(3-methoxyphenyl)-1-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridine (PubChem CID 10849883) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridine.
| Compound Name | 2-(3-methoxyphenyl)-1-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridine |
|---|---|
| PubChem CID | 10849883 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridine |
| SMILES | COc1cccc(C2CCC3CCCCCC3N2C)c1 |
| InChI | InChI=1S/C18H27NO/c1-19-17-10-5-3-4-7-14(17)11-12-18(19)15-8-6-9-16(13-15)20-2/h6,8-9,13-14,17-18H,3-5,7,10-12H2,1-2H3 |
| InChIKey | UPACRVWBHOEXRD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |