C16H23NO — CID 154523461
(3aS,4R,7aS)-4-(3-methoxyphenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154523461) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-(3-methoxyphenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,4R,7aS)-4-(3-methoxyphenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154523461 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (3aS,4R,7aS)-4-(3-methoxyphenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | COc1cccc([C@@H]2CCC[C@@H]3CN(C)C[C@H]32)c1 |
| InChI | InChI=1S/C16H23NO/c1-17-10-13-6-4-8-15(16(13)11-17)12-5-3-7-14(9-12)18-2/h3,5,7,9,13,15-16H,4,6,8,10-11H2,1-2H3/t13-,15+,16-/m1/s1 |
| InChIKey | BTRGGKZCEQRIGU-VNQPRFMTSA-N |
| XLogP | 3.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |