C16H20F3N — CID 67739877
(4S,7aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 67739877) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is (4S,7aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (4S,7aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 67739877 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (4S,7aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CN1CC2[C@@H](CCC[C@@H]2c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F3N/c1-20-9-12-5-3-7-14(15(12)10-20)11-4-2-6-13(8-11)16(17,18)19/h2,4,6,8,12,14-15H,3,5,7,9-10H2,1H3/t12-,14+,15?/m0/s1 |
| InChIKey | SZQMXNSWUDGIFM-DJIKBVBFSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |