C12H18N2O — CID 14361742
2-(3-methoxyphenyl)-1,3-dimethylimidazolidine (PubChem CID 14361742) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,3-dimethylimidazolidine.
| Compound Name | 2-(3-methoxyphenyl)-1,3-dimethylimidazolidine |
|---|---|
| PubChem CID | 14361742 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,3-dimethylimidazolidine |
| SMILES | COc1cccc(C2N(C)CCN2C)c1 |
| InChI | InChI=1S/C12H18N2O/c1-13-7-8-14(2)12(13)10-5-4-6-11(9-10)15-3/h4-6,9,12H,7-8H2,1-3H3 |
| InChIKey | SIQFFZNGYRDKHN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |