C12H15NO — CID 70452828
2-(3-methoxyphenyl)-1-methyl-2,5-dihydropyrrole (PubChem CID 70452828) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-methyl-2,5-dihydropyrrole.
| Compound Name | 2-(3-methoxyphenyl)-1-methyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 70452828 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-methyl-2,5-dihydropyrrole |
| SMILES | COc1cccc(C2C=CCN2C)c1 |
| InChI | InChI=1S/C12H15NO/c1-13-8-4-7-12(13)10-5-3-6-11(9-10)14-2/h3-7,9,12H,8H2,1-2H3 |
| InChIKey | NRPVTOMZXPOPEJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|