C13H21N3O3S — CID 110632012
3-(3-methoxyphenyl)-N,4-dimethylpiperazine-1-sulfonamide (PubChem CID 110632012) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N,4-dimethylpiperazine-1-sulfonamide.
| Compound Name | 3-(3-methoxyphenyl)-N,4-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 110632012 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-(3-methoxyphenyl)-N,4-dimethylpiperazine-1-sulfonamide |
| SMILES | CNS(=O)(=O)N1CCN(C)C(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C13H21N3O3S/c1-14-20(17,18)16-8-7-15(2)13(10-16)11-5-4-6-12(9-11)19-3/h4-6,9,13-14H,7-8,10H2,1-3H3 |
| InChIKey | MUGMMFAZXFNNPU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |