C16H19ClN2O3S2 — CID 110293346
4-(5-chlorothiophen-2-yl)sulfonyl-2-(3-methoxyphenyl)-1-methylpiperazine (PubChem CID 110293346) has the molecular formula C16H19ClN2O3S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-2-(3-methoxyphenyl)-1-methylpiperazine.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-2-(3-methoxyphenyl)-1-methylpiperazine |
|---|---|
| PubChem CID | 110293346 |
| Molecular Formula | C16H19ClN2O3S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-2-(3-methoxyphenyl)-1-methylpiperazine |
| SMILES | COc1cccc(C2CN(S(=O)(=O)c3ccc(Cl)s3)CCN2C)c1 |
| InChI | InChI=1S/C16H19ClN2O3S2/c1-18-8-9-19(24(20,21)16-7-6-15(17)23-16)11-14(18)12-4-3-5-13(10-12)22-2/h3-7,10,14H,8-9,11H2,1-2H3 |
| InChIKey | RKKFGNWCEOALLD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |