C17H22N2O4S2 — CID 110293430
2-(3,4-dimethoxyphenyl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 110293430) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 110293430 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | COc1ccc(C2CN(S(=O)(=O)c3cccs3)CCN2C)cc1OC |
| InChI | InChI=1S/C17H22N2O4S2/c1-18-8-9-19(25(20,21)17-5-4-10-24-17)12-14(18)13-6-7-15(22-2)16(11-13)23-3/h4-7,10-11,14H,8-9,12H2,1-3H3 |
| InChIKey | XNGDPNBHNLLDOT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |