C12H16N4O2S2 — CID 129334414
(2R)-2-(1H-imidazol-2-yl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 129334414) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 129334414 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2cccs2)C[C@@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-15-6-7-16(9-10(15)12-13-4-5-14-12)20(17,18)11-3-2-8-19-11/h2-5,8,10H,6-7,9H2,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | NPRSZCNBWLXPKT-SNVBAGLBSA-N |
| XLogP | 1.15 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |