C14H15F3N4O2S — CID 129339222
(2R)-2-(1H-imidazol-2-yl)-1-methyl-4-(3,4,5-trifluorophenyl)sulfonylpiperazine (PubChem CID 129339222) has the molecular formula C14H15F3N4O2S and a molecular weight of 360.36 g/mol. Its IUPAC name is (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-(3,4,5-trifluorophenyl)sulfonylpiperazine.
| Compound Name | (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-(3,4,5-trifluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 129339222 |
| Molecular Formula | C14H15F3N4O2S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (2R)-2-(1H-imidazol-2-yl)-1-methyl-4-(3,4,5-trifluorophenyl)sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2cc(F)c(F)c(F)c2)C[C@@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C14H15F3N4O2S/c1-20-4-5-21(8-12(20)14-18-2-3-19-14)24(22,23)9-6-10(15)13(17)11(16)7-9/h2-3,6-7,12H,4-5,8H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | VRJQUSLAPABEJY-GFCCVEGCSA-N |
| XLogP | 1.50 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|