C15H16FN5O2S — CID 128992465
2-fluoro-6-[3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]sulfonylbenzonitrile (PubChem CID 128992465) has the molecular formula C15H16FN5O2S and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-fluoro-6-[3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-fluoro-6-[3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 128992465 |
| Molecular Formula | C15H16FN5O2S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-fluoro-6-[3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]sulfonylbenzonitrile |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(F)c2C#N)CC1c1ncc[nH]1 |
| InChI | InChI=1S/C15H16FN5O2S/c1-20-7-8-21(10-13(20)15-18-5-6-19-15)24(22,23)14-4-2-3-12(16)11(14)9-17/h2-6,13H,7-8,10H2,1H3,(H,18,19) |
| InChIKey | DDRQKXSJCMFSPF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |