C16H24N4O2S2 — CID 129329058
(2S)-4-(5-tert-butylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)-1-methylpiperazine (PubChem CID 129329058) has the molecular formula C16H24N4O2S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is (2S)-4-(5-tert-butylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)-1-methylpiperazine.
| Compound Name | (2S)-4-(5-tert-butylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)-1-methylpiperazine |
|---|---|
| PubChem CID | 129329058 |
| Molecular Formula | C16H24N4O2S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2S)-4-(5-tert-butylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)-1-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(C(C)(C)C)s2)C[C@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C16H24N4O2S2/c1-16(2,3)13-5-6-14(23-13)24(21,22)20-10-9-19(4)12(11-20)15-17-7-8-18-15/h5-8,12H,9-11H2,1-4H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | DDOQQABOYVEDQS-LBPRGKRZSA-N |
| XLogP | 2.45 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |