C13H19NO4S — CID 129481403
(3R,5S)-1-ethylsulfonyl-5-(3-methoxyphenyl)pyrrolidin-3-ol (PubChem CID 129481403) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is (3R,5S)-1-ethylsulfonyl-5-(3-methoxyphenyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-1-ethylsulfonyl-5-(3-methoxyphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129481403 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (3R,5S)-1-ethylsulfonyl-5-(3-methoxyphenyl)pyrrolidin-3-ol |
| SMILES | CCS(=O)(=O)N1C[C@H](O)C[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-19(16,17)14-9-11(15)8-13(14)10-5-4-6-12(7-10)18-2/h4-7,11,13,15H,3,8-9H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | VEJPEGOAQDRGRP-YPMHNXCESA-N |
| XLogP | 1.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |