C16H23NO3 — CID 102517137
(2R,4aR,7aR)-2-(3,4-dimethoxyphenyl)-1-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine (PubChem CID 102517137) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2R,4aR,7aR)-2-(3,4-dimethoxyphenyl)-1-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine.
| Compound Name | (2R,4aR,7aR)-2-(3,4-dimethoxyphenyl)-1-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 102517137 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2R,4aR,7aR)-2-(3,4-dimethoxyphenyl)-1-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
| SMILES | COc1ccc([C@H]2CC[C@H]3CCC[C@H]3N2O)cc1OC |
| InChI | InChI=1S/C16H23NO3/c1-19-15-9-7-12(10-16(15)20-2)14-8-6-11-4-3-5-13(11)17(14)18/h7,9-11,13-14,18H,3-6,8H2,1-2H3/t11-,13-,14-/m1/s1 |
| InChIKey | KDODYRCBOWSERS-MRVWCRGKSA-N |
| XLogP | 3.40 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |