C16H23NO2 — CID 71301921
1-(3,4-dimethoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 71301921) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 71301921 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | COc1ccc(C2CCN3CCCCC23)cc1OC |
| InChI | InChI=1S/C16H23NO2/c1-18-15-7-6-12(11-16(15)19-2)13-8-10-17-9-4-3-5-14(13)17/h6-7,11,13-14H,3-5,8-10H2,1-2H3 |
| InChIKey | NGKYOIDNLPASNC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |