C23H32N2O4 — CID 18655775
3-(3,4-dimethoxyphenyl)-1-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]piperidine-2,4-dione (PubChem CID 18655775) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]piperidine-2,4-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 18655775 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]piperidine-2,4-dione |
| SMILES | COc1ccc(C2C(=O)CCN([C@@H]3CCCC[C@H]3N3CCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C23H32N2O4/c1-28-20-10-9-16(15-21(20)29-2)22-19(26)11-14-25(23(22)27)18-8-4-3-7-17(18)24-12-5-6-13-24/h9-10,15,17-18,22H,3-8,11-14H2,1-2H3/t17-,18-,22?/m1/s1 |
| InChIKey | IQZUGJRCBFWYCQ-XWATYHNTSA-N |
| XLogP | 3.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|