C16H23NO3 — CID 11288928
3-(3,4-dimethoxyphenyl)-1-propylpiperidin-2-one (PubChem CID 11288928) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-propylpiperidin-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-propylpiperidin-2-one |
|---|---|
| PubChem CID | 11288928 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-propylpiperidin-2-one |
| SMILES | CCCN1CCCC(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C16H23NO3/c1-4-9-17-10-5-6-13(16(17)18)12-7-8-14(19-2)15(11-12)20-3/h7-8,11,13H,4-6,9-10H2,1-3H3 |
| InChIKey | MOXXEXFJSJJNGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |