C18H25NO2 — CID 15839376
(6S,9aS)-6-(3,4-dimethoxyphenyl)-8-methylidene-1,2,3,4,6,7,9,9a-octahydroquinolizine (PubChem CID 15839376) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (6S,9aS)-6-(3,4-dimethoxyphenyl)-8-methylidene-1,2,3,4,6,7,9,9a-octahydroquinolizine.
| Compound Name | (6S,9aS)-6-(3,4-dimethoxyphenyl)-8-methylidene-1,2,3,4,6,7,9,9a-octahydroquinolizine |
|---|---|
| PubChem CID | 15839376 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (6S,9aS)-6-(3,4-dimethoxyphenyl)-8-methylidene-1,2,3,4,6,7,9,9a-octahydroquinolizine |
| SMILES | C=C1C[C@@H]2CCCCN2[C@H](c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C18H25NO2/c1-13-10-15-6-4-5-9-19(15)16(11-13)14-7-8-17(20-2)18(12-14)21-3/h7-8,12,15-16H,1,4-6,9-11H2,2-3H3/t15-,16-/m0/s1 |
| InChIKey | AAMCZGFDDFEBNI-HOTGVXAUSA-N |
| XLogP | 3.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|