C22H26ClFN2O2 — CID 10294673
2-(4-chloro-3-fluorophenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 10294673) has the molecular formula C22H26ClFN2O2 and a molecular weight of 404.91 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 10294673 |
| Molecular Formula | C22H26ClFN2O2 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | COc1ccc(C2CCCC3CN(c4ccc(Cl)c(F)c4)CCN32)cc1OC |
| InChI | InChI=1S/C22H26ClFN2O2/c1-27-21-9-6-15(12-22(21)28-2)20-5-3-4-17-14-25(10-11-26(17)20)16-7-8-18(23)19(24)13-16/h6-9,12-13,17,20H,3-5,10-11,14H2,1-2H3 |
| InChIKey | PGNSQNBDDDDZCZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |